About 1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea
1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea (PubChem CID 91911076) has the molecular formula C15H26N6O2
and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea.
Molecular Properties
| Compound Name | 1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea |
| PubChem CID | 91911076 |
| Molecular Formula | C15H26N6O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)N[C@@H]1CN(c2ncccn2)C[C@H]1CN(C)C |
| InChI | InChI=1S/C15H26N6O2/c1-20(2)9-12-10-21(14-16-5-4-6-17-14)11-13(12)19-15(22)18-7-8-23-3/h4-6,12-13H,7-11H2,1-3H3,(H2,18,19,22)/t12-,13-/m1/s1 |
| InChIKey | JCPAOWKZVITPKK-CHWSQXEVSA-N |
| XLogP | -0.21 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea?
The IUPAC name of 1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea (CID 91911076) is 1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea.
What is the SMILES notation for 1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea?
The canonical SMILES for 1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea is COCCNC(=O)N[C@@H]1CN(c2ncccn2)C[C@H]1CN(C)C.
What is the InChIKey of 1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea?
The InChIKey is JCPAOWKZVITPKK-CHWSQXEVSA-N. The full InChI is InChI=1S/C15H26N6O2/c1-20(2)9-12-10-21(14-16-5-4-6-17-14)11-13(12)19-15(22)18-7-8-23-3/h4-6,12-13H,7-11H2,1-3H3,(H2,18,19,22)/t12-,13-/m1/s1.
What are the key properties of 1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea?
1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea has a molecular weight of 322.41 g/mol, XLogP of -0.21, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,4R)-4-[(dimethylamino)methyl]-1-pyrimidin-2-ylpyrrolidin-3-yl]-3-(2-methoxyethyl)urea is sourced from PubChem (CID 91911076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).