C18H22N4O5 — CID 91911404
methyl 2-[[3-[3-(2-phenylmethoxyethyl)-1,2,4-oxadiazol-5-yl]azetidine-1-carbonyl]amino]acetate (PubChem CID 91911404) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is methyl 2-[[3-[3-(2-phenylmethoxyethyl)-1,2,4-oxadiazol-5-yl]azetidine-1-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[3-[3-(2-phenylmethoxyethyl)-1,2,4-oxadiazol-5-yl]azetidine-1-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 91911404 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | methyl 2-[[3-[3-(2-phenylmethoxyethyl)-1,2,4-oxadiazol-5-yl]azetidine-1-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)N1CC(c2nc(CCOCc3ccccc3)no2)C1 |
| InChI | InChI=1S/C18H22N4O5/c1-25-16(23)9-19-18(24)22-10-14(11-22)17-20-15(21-27-17)7-8-26-12-13-5-3-2-4-6-13/h2-6,14H,7-12H2,1H3,(H,19,24) |
| InChIKey | IKPCWIKJGCMVQV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|