About 2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide
2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide (PubChem CID 91912590) has the molecular formula C18H31N3O3
and a molecular weight of 337.46 g/mol. Its IUPAC name is 2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide.
Molecular Properties
| Compound Name | 2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide |
| PubChem CID | 91912590 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide |
| SMILES | CN(C)C(=O)C1CN(C(=O)NC2CCCCC2)CC12CCOCC2 |
| InChI | InChI=1S/C18H31N3O3/c1-20(2)16(22)15-12-21(13-18(15)8-10-24-11-9-18)17(23)19-14-6-4-3-5-7-14/h14-15H,3-13H2,1-2H3,(H,19,23) |
| InChIKey | NMTGPINEVMWEJS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide?
The IUPAC name of 2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide (CID 91912590) is 2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide.
What is the SMILES notation for 2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide?
The canonical SMILES for 2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide is CN(C)C(=O)C1CN(C(=O)NC2CCCCC2)CC12CCOCC2.
What is the InChIKey of 2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide?
The InChIKey is NMTGPINEVMWEJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N3O3/c1-20(2)16(22)15-12-21(13-18(15)8-10-24-11-9-18)17(23)19-14-6-4-3-5-7-14/h14-15H,3-13H2,1-2H3,(H,19,23).
What are the key properties of 2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide?
2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide has a molecular weight of 337.46 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-cyclohexyl-4-N,4-N-dimethyl-8-oxa-2-azaspiro[4.5]decane-2,4-dicarboxamide is sourced from PubChem (CID 91912590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).