About N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide
N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide (PubChem CID 91912695) has the molecular formula C21H28F2N2O4S
and a molecular weight of 442.53 g/mol. Its IUPAC name is N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide |
| PubChem CID | 91912695 |
| Molecular Formula | C21H28F2N2O4S |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1CN(S(=O)(=O)c2cc(F)ccc2F)CC12CCOCC2 |
| InChI | InChI=1S/C21H28F2N2O4S/c22-15-6-7-18(23)19(12-15)30(27,28)25-13-17(21(14-25)8-10-29-11-9-21)20(26)24-16-4-2-1-3-5-16/h6-7,12,16-17H,1-5,8-11,13-14H2,(H,24,26) |
| InChIKey | BRIIARSVLVZEDU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide?
The IUPAC name of N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide (CID 91912695) is N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide.
What is the SMILES notation for N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide?
The canonical SMILES for N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide is O=C(NC1CCCCC1)C1CN(S(=O)(=O)c2cc(F)ccc2F)CC12CCOCC2.
What is the InChIKey of N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide?
The InChIKey is BRIIARSVLVZEDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28F2N2O4S/c22-15-6-7-18(23)19(12-15)30(27,28)25-13-17(21(14-25)8-10-29-11-9-21)20(26)24-16-4-2-1-3-5-16/h6-7,12,16-17H,1-5,8-11,13-14H2,(H,24,26).
What are the key properties of N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide?
N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide has a molecular weight of 442.53 g/mol, XLogP of 2.83, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-2-(2,5-difluorophenyl)sulfonyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide is sourced from PubChem (CID 91912695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).