C20H33N3O3 — CID 91912795
1-(2-methoxyethyl)-2-oxo-N-(3-pyrrolidin-1-ylpropyl)-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxamide (PubChem CID 91912795) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2-oxo-N-(3-pyrrolidin-1-ylpropyl)-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-2-oxo-N-(3-pyrrolidin-1-ylpropyl)-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxamide |
|---|---|
| PubChem CID | 91912795 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | 1-(2-methoxyethyl)-2-oxo-N-(3-pyrrolidin-1-ylpropyl)-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxamide |
| SMILES | COCCN1C(=O)CCC2(C(=O)NCCCN3CCCC3)CCCC=C12 |
| InChI | InChI=1S/C20H33N3O3/c1-26-16-15-23-17-7-2-3-9-20(17,10-8-18(23)24)19(25)21-11-6-14-22-12-4-5-13-22/h7H,2-6,8-16H2,1H3,(H,21,25) |
| InChIKey | RBOLKMHUDRTGER-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|