About 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one
1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one (PubChem CID 91912881) has the molecular formula C20H26F2N2O2
and a molecular weight of 364.44 g/mol. Its IUPAC name is 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one.
Molecular Properties
| Compound Name | 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one |
| PubChem CID | 91912881 |
| Molecular Formula | C20H26F2N2O2 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one |
| SMILES | O=C1C(O)C2(CCCCC2)N1C1CCN(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C20H26F2N2O2/c21-16-5-4-14(12-17(16)22)13-23-10-6-15(7-11-23)24-19(26)18(25)20(24)8-2-1-3-9-20/h4-5,12,15,18,25H,1-3,6-11,13H2 |
| InChIKey | QOFFCZHTRSNQFX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one?
The IUPAC name of 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one (CID 91912881) is 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one.
What is the SMILES notation for 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one?
The canonical SMILES for 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one is O=C1C(O)C2(CCCCC2)N1C1CCN(Cc2ccc(F)c(F)c2)CC1.
What is the InChIKey of 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one?
The InChIKey is QOFFCZHTRSNQFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26F2N2O2/c21-16-5-4-14(12-17(16)22)13-23-10-6-15(7-11-23)24-19(26)18(25)20(24)8-2-1-3-9-20/h4-5,12,15,18,25H,1-3,6-11,13H2.
What are the key properties of 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one?
1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one has a molecular weight of 364.44 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-hydroxy-1-azaspiro[3.5]nonan-2-one is sourced from PubChem (CID 91912881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).