C18H24N3O3S+ — CID 9191327
[4-[[(4-acetamidophenyl)sulfonylamino]methyl]phenyl]methyl-dimethylazanium (PubChem CID 9191327) has the molecular formula C18H24N3O3S+ and a molecular weight of 362.48 g/mol. Its IUPAC name is [4-[[(4-acetamidophenyl)sulfonylamino]methyl]phenyl]methyl-dimethylazanium.
| Compound Name | [4-[[(4-acetamidophenyl)sulfonylamino]methyl]phenyl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 9191327 |
| Molecular Formula | C18H24N3O3S+ |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | [4-[[(4-acetamidophenyl)sulfonylamino]methyl]phenyl]methyl-dimethylazanium |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCc2ccc(C[NH+](C)C)cc2)cc1 |
| InChI | InChI=1S/C18H23N3O3S/c1-14(22)20-17-8-10-18(11-9-17)25(23,24)19-12-15-4-6-16(7-5-15)13-21(2)3/h4-11,19H,12-13H2,1-3H3,(H,20,22)/p+1 |
| InChIKey | TVTPFPKYPCHUDD-UHFFFAOYSA-O |
| XLogP | 0.77 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |