C21H29N2O4S+ — CID 9191483
1-[(2-methoxy-5-methylphenyl)methyl]-4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium (PubChem CID 9191483) has the molecular formula C21H29N2O4S+ and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-[(2-methoxy-5-methylphenyl)methyl]-4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-[(2-methoxy-5-methylphenyl)methyl]-4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 9191483 |
| Molecular Formula | C21H29N2O4S+ |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 1-[(2-methoxy-5-methylphenyl)methyl]-4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium |
| SMILES | COc1ccc(C)cc1C[NH+]1CCN(S(=O)(=O)c2cc(C)ccc2OC)CC1 |
| InChI | InChI=1S/C21H28N2O4S/c1-16-5-7-19(26-3)18(13-16)15-22-9-11-23(12-10-22)28(24,25)21-14-17(2)6-8-20(21)27-4/h5-8,13-14H,9-12,15H2,1-4H3/p+1 |
| InChIKey | WMSMAHBNPZCOND-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |