C17H23N5O3 — CID 91915211
N-(3-ethoxypropyl)-3-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)pyrrolidine-1-carboxamide (PubChem CID 91915211) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-3-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)pyrrolidine-1-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-3-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 91915211 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-(3-ethoxypropyl)-3-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)pyrrolidine-1-carboxamide |
| SMILES | CCOCCCNC(=O)N1CCC(c2noc(-c3ccncc3)n2)C1 |
| InChI | InChI=1S/C17H23N5O3/c1-2-24-11-3-7-19-17(23)22-10-6-14(12-22)15-20-16(25-21-15)13-4-8-18-9-5-13/h4-5,8-9,14H,2-3,6-7,10-12H2,1H3,(H,19,23) |
| InChIKey | BCILHFZQRIECDU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|