C14H19ClFNO3S — CID 91915412
3-chloro-4-fluoro-N-(oxolan-3-ylmethyl)-N-propylbenzenesulfonamide (PubChem CID 91915412) has the molecular formula C14H19ClFNO3S and a molecular weight of 335.83 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-(oxolan-3-ylmethyl)-N-propylbenzenesulfonamide.
| Compound Name | 3-chloro-4-fluoro-N-(oxolan-3-ylmethyl)-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 91915412 |
| Molecular Formula | C14H19ClFNO3S |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 3-chloro-4-fluoro-N-(oxolan-3-ylmethyl)-N-propylbenzenesulfonamide |
| SMILES | CCCN(CC1CCOC1)S(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClFNO3S/c1-2-6-17(9-11-5-7-20-10-11)21(18,19)12-3-4-14(16)13(15)8-12/h3-4,8,11H,2,5-7,9-10H2,1H3 |
| InChIKey | QBZBMHINNHHHCO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |