About 1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea
1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea (PubChem CID 91915427) has the molecular formula C15H19F3N2O2
and a molecular weight of 316.32 g/mol. Its IUPAC name is 1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea.
Molecular Properties
| Compound Name | 1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea |
| PubChem CID | 91915427 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea |
| SMILES | CCCN(CC1CCOC1)C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-2-4-20(8-10-3-5-22-9-10)15(21)19-11-6-12(16)14(18)13(17)7-11/h6-7,10H,2-5,8-9H2,1H3,(H,19,21) |
| InChIKey | NIYKXIGNEUDXMG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea?
The IUPAC name of 1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea (CID 91915427) is 1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea.
What is the SMILES notation for 1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea?
The canonical SMILES for 1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea is CCCN(CC1CCOC1)C(=O)Nc1cc(F)c(F)c(F)c1.
What is the InChIKey of 1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea?
The InChIKey is NIYKXIGNEUDXMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F3N2O2/c1-2-4-20(8-10-3-5-22-9-10)15(21)19-11-6-12(16)14(18)13(17)7-11/h6-7,10H,2-5,8-9H2,1H3,(H,19,21).
What are the key properties of 1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea?
1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea has a molecular weight of 316.32 g/mol, XLogP of 3.38, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-3-ylmethyl)-1-propyl-3-(3,4,5-trifluorophenyl)urea is sourced from PubChem (CID 91915427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).