C14H24N4O3S — CID 91915784
(5aS,9aS)-8-(1-ethylpyrazol-4-yl)sulfonyl-1-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepine (PubChem CID 91915784) has the molecular formula C14H24N4O3S and a molecular weight of 328.44 g/mol. Its IUPAC name is (5aS,9aS)-8-(1-ethylpyrazol-4-yl)sulfonyl-1-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepine.
| Compound Name | (5aS,9aS)-8-(1-ethylpyrazol-4-yl)sulfonyl-1-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepine |
|---|---|
| PubChem CID | 91915784 |
| Molecular Formula | C14H24N4O3S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (5aS,9aS)-8-(1-ethylpyrazol-4-yl)sulfonyl-1-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepine |
| SMILES | CCn1cc(S(=O)(=O)N2CC[C@@H]3COCCN(C)[C@@H]3C2)cn1 |
| InChI | InChI=1S/C14H24N4O3S/c1-3-17-9-13(8-15-17)22(19,20)18-5-4-12-11-21-7-6-16(2)14(12)10-18/h8-9,12,14H,3-7,10-11H2,1-2H3/t12-,14-/m1/s1 |
| InChIKey | JTWYHWMAVHUNBS-TZMCWYRMSA-N |
| XLogP | 0.24 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |