C21H20ClFN2O2 — CID 91916065
(3aR,6aS)-2-[(4-chloro-3-fluorophenyl)methyl]-5-(2-phenylethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 91916065) has the molecular formula C21H20ClFN2O2 and a molecular weight of 386.85 g/mol. Its IUPAC name is (3aR,6aS)-2-[(4-chloro-3-fluorophenyl)methyl]-5-(2-phenylethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3aR,6aS)-2-[(4-chloro-3-fluorophenyl)methyl]-5-(2-phenylethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 91916065 |
| Molecular Formula | C21H20ClFN2O2 |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (3aR,6aS)-2-[(4-chloro-3-fluorophenyl)methyl]-5-(2-phenylethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | O=C1[C@H]2CN(Cc3ccc(Cl)c(F)c3)C[C@H]2C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C21H20ClFN2O2/c22-18-7-6-15(10-19(18)23)11-24-12-16-17(13-24)21(27)25(20(16)26)9-8-14-4-2-1-3-5-14/h1-7,10,16-17H,8-9,11-13H2/t16-,17+ |
| InChIKey | OFEROKYFDRGYOI-CALCHBBNSA-N |
| XLogP | 3.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|