C19H29N5S — CID 91916139
11-(3-methylbutyl)-3-(4-methylpiperazin-1-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene (PubChem CID 91916139) has the molecular formula C19H29N5S and a molecular weight of 359.54 g/mol. Its IUPAC name is 11-(3-methylbutyl)-3-(4-methylpiperazin-1-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene.
| Compound Name | 11-(3-methylbutyl)-3-(4-methylpiperazin-1-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene |
|---|---|
| PubChem CID | 91916139 |
| Molecular Formula | C19H29N5S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 11-(3-methylbutyl)-3-(4-methylpiperazin-1-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene |
| SMILES | CC(C)CCN1CCc2c(sc3ncnc(N4CCN(C)CC4)c23)C1 |
| InChI | InChI=1S/C19H29N5S/c1-14(2)4-6-23-7-5-15-16(12-23)25-19-17(15)18(20-13-21-19)24-10-8-22(3)9-11-24/h13-14H,4-12H2,1-3H3 |
| InChIKey | HXEJLXAWJIVXQT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |