C16H26N4O4S — CID 91916386
(1-methylimidazol-4-yl)-[4-(1-methylsulfonylpiperidin-4-yl)oxypiperidin-1-yl]methanone (PubChem CID 91916386) has the molecular formula C16H26N4O4S and a molecular weight of 370.48 g/mol. Its IUPAC name is (1-methylimidazol-4-yl)-[4-(1-methylsulfonylpiperidin-4-yl)oxypiperidin-1-yl]methanone.
| Compound Name | (1-methylimidazol-4-yl)-[4-(1-methylsulfonylpiperidin-4-yl)oxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 91916386 |
| Molecular Formula | C16H26N4O4S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (1-methylimidazol-4-yl)-[4-(1-methylsulfonylpiperidin-4-yl)oxypiperidin-1-yl]methanone |
| SMILES | Cn1cnc(C(=O)N2CCC(OC3CCN(S(C)(=O)=O)CC3)CC2)c1 |
| InChI | InChI=1S/C16H26N4O4S/c1-18-11-15(17-12-18)16(21)19-7-3-13(4-8-19)24-14-5-9-20(10-6-14)25(2,22)23/h11-14H,3-10H2,1-2H3 |
| InChIKey | OEODRODANAEXOG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |