C13H22N4O2 — CID 91916541
N-(3-methylbutyl)-2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)acetamide (PubChem CID 91916541) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)acetamide.
| Compound Name | N-(3-methylbutyl)-2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)acetamide |
|---|---|
| PubChem CID | 91916541 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | N-(3-methylbutyl)-2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)acetamide |
| SMILES | CC(C)CCNC(=O)Cn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C13H22N4O2/c1-10(2)6-7-14-12(18)9-17-13(19)16-8-4-3-5-11(16)15-17/h10H,3-9H2,1-2H3,(H,14,18) |
| InChIKey | IIZCGRUWAXVONJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |