C23H28N4O6S — CID 91916786
[5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methyl 2-[(4-methoxyphenyl)methyl]-5-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate (PubChem CID 91916786) has the molecular formula C23H28N4O6S and a molecular weight of 488.57 g/mol. Its IUPAC name is [5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methyl 2-[(4-methoxyphenyl)methyl]-5-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate.
| Compound Name | [5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methyl 2-[(4-methoxyphenyl)methyl]-5-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate |
|---|---|
| PubChem CID | 91916786 |
| Molecular Formula | C23H28N4O6S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methyl 2-[(4-methoxyphenyl)methyl]-5-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate |
| SMILES | COc1ccc(CN2C=C(C(=O)OCc3noc(CC4CCCCC4)n3)C(C)=NS2(=O)=O)cc1 |
| InChI | InChI=1S/C23H28N4O6S/c1-16-20(14-27(34(29,30)26-16)13-18-8-10-19(31-2)11-9-18)23(28)32-15-21-24-22(33-25-21)12-17-6-4-3-5-7-17/h8-11,14,17H,3-7,12-13,15H2,1-2H3 |
| InChIKey | WKITVDREVIXEAU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 124.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |