C18H23N5O2 — CID 91916966
1-(oxolan-2-ylmethyl)-3-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]urea (PubChem CID 91916966) has the molecular formula C18H23N5O2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-3-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]urea.
| Compound Name | 1-(oxolan-2-ylmethyl)-3-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 91916966 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-3-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]urea |
| SMILES | O=C(NCC1CCCO1)Nc1cccc(-c2nnc3n2CCCC3)c1 |
| InChI | InChI=1S/C18H23N5O2/c24-18(19-12-15-7-4-10-25-15)20-14-6-3-5-13(11-14)17-22-21-16-8-1-2-9-23(16)17/h3,5-6,11,15H,1-2,4,7-10,12H2,(H2,19,20,24) |
| InChIKey | OGIJLWYAAVWRBY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |