About N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide
N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide (PubChem CID 91917666) has the molecular formula C18H23N3O2
and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide.
Molecular Properties
| Compound Name | N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide |
| PubChem CID | 91917666 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide |
| SMILES | O=C(CC1CCCC1)NCCc1noc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C18H23N3O2/c22-17(12-14-8-4-5-9-14)19-11-10-16-20-18(23-21-16)13-15-6-2-1-3-7-15/h1-3,6-7,14H,4-5,8-13H2,(H,19,22) |
| InChIKey | KTVULIHKMSKYLB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide?
The IUPAC name of N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide (CID 91917666) is N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide.
What is the SMILES notation for N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide?
The canonical SMILES for N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide is O=C(CC1CCCC1)NCCc1noc(Cc2ccccc2)n1.
What is the InChIKey of N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide?
The InChIKey is KTVULIHKMSKYLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O2/c22-17(12-14-8-4-5-9-14)19-11-10-16-20-18(23-21-16)13-15-6-2-1-3-7-15/h1-3,6-7,14H,4-5,8-13H2,(H,19,22).
What are the key properties of N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide?
N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide has a molecular weight of 313.40 g/mol, XLogP of 2.90, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5-benzyl-1,2,4-oxadiazol-3-yl)ethyl]-2-cyclopentylacetamide is sourced from PubChem (CID 91917666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).