C19H20N4O2 — CID 91917673
4-phenyl-N-[2-(5-pyridin-3-yl-1,2,4-oxadiazol-3-yl)ethyl]butanamide (PubChem CID 91917673) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 4-phenyl-N-[2-(5-pyridin-3-yl-1,2,4-oxadiazol-3-yl)ethyl]butanamide.
| Compound Name | 4-phenyl-N-[2-(5-pyridin-3-yl-1,2,4-oxadiazol-3-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 91917673 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-phenyl-N-[2-(5-pyridin-3-yl-1,2,4-oxadiazol-3-yl)ethyl]butanamide |
| SMILES | O=C(CCCc1ccccc1)NCCc1noc(-c2cccnc2)n1 |
| InChI | InChI=1S/C19H20N4O2/c24-18(10-4-8-15-6-2-1-3-7-15)21-13-11-17-22-19(25-23-17)16-9-5-12-20-14-16/h1-3,5-7,9,12,14H,4,8,10-11,13H2,(H,21,24) |
| InChIKey | VZOUVDRXXQIMQW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |