About 3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one
3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one (PubChem CID 91917896) has the molecular formula C19H28N2O3
and a molecular weight of 332.44 g/mol. Its IUPAC name is 3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one.
Molecular Properties
| Compound Name | 3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one |
| PubChem CID | 91917896 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one |
| SMILES | COCCOc1ccc2c(n1)CCN(C(=O)CCC1CCCC1)C2 |
| InChI | InChI=1S/C19H28N2O3/c1-23-12-13-24-18-8-7-16-14-21(11-10-17(16)20-18)19(22)9-6-15-4-2-3-5-15/h7-8,15H,2-6,9-14H2,1H3 |
| InChIKey | CENLBGVPQPLYHI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one?
The IUPAC name of 3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one (CID 91917896) is 3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one.
What is the SMILES notation for 3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one?
The canonical SMILES for 3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one is COCCOc1ccc2c(n1)CCN(C(=O)CCC1CCCC1)C2.
What is the InChIKey of 3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one?
The InChIKey is CENLBGVPQPLYHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O3/c1-23-12-13-24-18-8-7-16-14-21(11-10-17(16)20-18)19(22)9-6-15-4-2-3-5-15/h7-8,15H,2-6,9-14H2,1H3.
What are the key properties of 3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one?
3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one has a molecular weight of 332.44 g/mol, XLogP of 2.96, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one is sourced from PubChem (CID 91917896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).