About [2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone
[2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone (PubChem CID 91917926) has the molecular formula C19H19FN2O2
and a molecular weight of 326.37 g/mol. Its IUPAC name is [2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone.
Molecular Properties
| Compound Name | [2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone |
| PubChem CID | 91917926 |
| Molecular Formula | C19H19FN2O2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCc2nc(OCC3CC3)ccc2C1 |
| InChI | InChI=1S/C19H19FN2O2/c20-16-6-3-14(4-7-16)19(23)22-10-9-17-15(11-22)5-8-18(21-17)24-12-13-1-2-13/h3-8,13H,1-2,9-12H2 |
| InChIKey | SAABXKTWFSSVEG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone?
The IUPAC name of [2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone (CID 91917926) is [2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone.
What is the SMILES notation for [2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone?
The canonical SMILES for [2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone is O=C(c1ccc(F)cc1)N1CCc2nc(OCC3CC3)ccc2C1.
What is the InChIKey of [2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone?
The InChIKey is SAABXKTWFSSVEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN2O2/c20-16-6-3-14(4-7-16)19(23)22-10-9-17-15(11-22)5-8-18(21-17)24-12-13-1-2-13/h3-8,13H,1-2,9-12H2.
What are the key properties of [2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone?
[2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone has a molecular weight of 326.37 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyclopropylmethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone is sourced from PubChem (CID 91917926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).