About N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide
N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide (PubChem CID 91919247) has the molecular formula C14H23N3O4
and a molecular weight of 297.35 g/mol. Its IUPAC name is N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide.
Molecular Properties
| Compound Name | N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide |
| PubChem CID | 91919247 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide |
| SMILES | CCCCN(C)C(=O)CN1C(=O)NC2(CCOCC2)C1=O |
| InChI | InChI=1S/C14H23N3O4/c1-3-4-7-16(2)11(18)10-17-12(19)14(15-13(17)20)5-8-21-9-6-14/h3-10H2,1-2H3,(H,15,20) |
| InChIKey | GEIIHIDSSVYTLO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide?
The IUPAC name of N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide (CID 91919247) is N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide.
What is the SMILES notation for N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide?
The canonical SMILES for N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide is CCCCN(C)C(=O)CN1C(=O)NC2(CCOCC2)C1=O.
What is the InChIKey of N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide?
The InChIKey is GEIIHIDSSVYTLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O4/c1-3-4-7-16(2)11(18)10-17-12(19)14(15-13(17)20)5-8-21-9-6-14/h3-10H2,1-2H3,(H,15,20).
What are the key properties of N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide?
N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide has a molecular weight of 297.35 g/mol, XLogP of 0.35, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)-N-methylacetamide is sourced from PubChem (CID 91919247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).