C19H15Cl2N3O3 — CID 9191963
N-(5-chloro-2-methoxyphenyl)-1-(4-chlorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide (PubChem CID 9191963) has the molecular formula C19H15Cl2N3O3 and a molecular weight of 404.25 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-1-(4-chlorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-1-(4-chlorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 9191963 |
| Molecular Formula | C19H15Cl2N3O3 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-1-(4-chlorophenyl)-6-methyl-4-oxopyridazine-3-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)c1nn(-c2ccc(Cl)cc2)c(C)cc1=O |
| InChI | InChI=1S/C19H15Cl2N3O3/c1-11-9-16(25)18(23-24(11)14-6-3-12(20)4-7-14)19(26)22-15-10-13(21)5-8-17(15)27-2/h3-10H,1-2H3,(H,22,26) |
| InChIKey | MPZGIZWYFUCWHW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |