About 4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one
4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 91920524) has the molecular formula C18H24N2O3S
and a molecular weight of 348.47 g/mol. Its IUPAC name is 4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one.
Molecular Properties
| Compound Name | 4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one |
| PubChem CID | 91920524 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | CN1C(=O)CS(=O)C12CCN(C(=O)CCCc1ccccc1)CC2 |
| InChI | InChI=1S/C18H24N2O3S/c1-19-17(22)14-24(23)18(19)10-12-20(13-11-18)16(21)9-5-8-15-6-3-2-4-7-15/h2-4,6-7H,5,8-14H2,1H3 |
| InChIKey | LZNFGEYZVLQARJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
The IUPAC name of 4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one (CID 91920524) is 4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one.
What is the SMILES notation for 4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
The canonical SMILES for 4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one is CN1C(=O)CS(=O)C12CCN(C(=O)CCCc1ccccc1)CC2.
What is the InChIKey of 4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
The InChIKey is LZNFGEYZVLQARJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O3S/c1-19-17(22)14-24(23)18(19)10-12-20(13-11-18)16(21)9-5-8-15-6-3-2-4-7-15/h2-4,6-7H,5,8-14H2,1H3.
What are the key properties of 4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one has a molecular weight of 348.47 g/mol, XLogP of 1.55, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-oxo-8-(4-phenylbutanoyl)-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one is sourced from PubChem (CID 91920524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).