C16H28N4O3S — CID 91920583
1-(1-methylimidazol-4-yl)sulfonyl-N-(2-methylpropyl)-N-(oxan-4-yl)azetidin-3-amine (PubChem CID 91920583) has the molecular formula C16H28N4O3S and a molecular weight of 356.49 g/mol. Its IUPAC name is 1-(1-methylimidazol-4-yl)sulfonyl-N-(2-methylpropyl)-N-(oxan-4-yl)azetidin-3-amine.
| Compound Name | 1-(1-methylimidazol-4-yl)sulfonyl-N-(2-methylpropyl)-N-(oxan-4-yl)azetidin-3-amine |
|---|---|
| PubChem CID | 91920583 |
| Molecular Formula | C16H28N4O3S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1-(1-methylimidazol-4-yl)sulfonyl-N-(2-methylpropyl)-N-(oxan-4-yl)azetidin-3-amine |
| SMILES | CC(C)CN(C1CCOCC1)C1CN(S(=O)(=O)c2cn(C)cn2)C1 |
| InChI | InChI=1S/C16H28N4O3S/c1-13(2)8-20(14-4-6-23-7-5-14)15-9-19(10-15)24(21,22)16-11-18(3)12-17-16/h11-15H,4-10H2,1-3H3 |
| InChIKey | ZMMZYMJAMSUBIZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |