C23H26N4O3 — CID 91920787
(6-methyl-3-pyridinyl)-[2-[3-(2-phenylmethoxyethyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methanone (PubChem CID 91920787) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is (6-methyl-3-pyridinyl)-[2-[3-(2-phenylmethoxyethyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methanone.
| Compound Name | (6-methyl-3-pyridinyl)-[2-[3-(2-phenylmethoxyethyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 91920787 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (6-methyl-3-pyridinyl)-[2-[3-(2-phenylmethoxyethyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCCCC2c2nc(CCOCc3ccccc3)no2)cn1 |
| InChI | InChI=1S/C23H26N4O3/c1-17-10-11-19(15-24-17)23(28)27-13-6-5-9-20(27)22-25-21(26-30-22)12-14-29-16-18-7-3-2-4-8-18/h2-4,7-8,10-11,15,20H,5-6,9,12-14,16H2,1H3 |
| InChIKey | LBELETFROXLZBX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|