C21H33N5O2 — CID 91920798
3-[2-(cyclopentylmethoxy)ethyl]-5-[1-[(1-ethylpyrazol-4-yl)methyl]piperidin-2-yl]-1,2,4-oxadiazole (PubChem CID 91920798) has the molecular formula C21H33N5O2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 3-[2-(cyclopentylmethoxy)ethyl]-5-[1-[(1-ethylpyrazol-4-yl)methyl]piperidin-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-[2-(cyclopentylmethoxy)ethyl]-5-[1-[(1-ethylpyrazol-4-yl)methyl]piperidin-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 91920798 |
| Molecular Formula | C21H33N5O2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 3-[2-(cyclopentylmethoxy)ethyl]-5-[1-[(1-ethylpyrazol-4-yl)methyl]piperidin-2-yl]-1,2,4-oxadiazole |
| SMILES | CCn1cc(CN2CCCCC2c2nc(CCOCC3CCCC3)no2)cn1 |
| InChI | InChI=1S/C21H33N5O2/c1-2-26-15-18(13-22-26)14-25-11-6-5-9-19(25)21-23-20(24-28-21)10-12-27-16-17-7-3-4-8-17/h13,15,17,19H,2-12,14,16H2,1H3 |
| InChIKey | QPHPXGYBNXCNLX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 69.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|