C15H14ClN3OS — CID 919208
13-chloro-4,4,8-trimethyl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12(17),13,15-hexaene (PubChem CID 919208) has the molecular formula C15H14ClN3OS and a molecular weight of 319.82 g/mol. Its IUPAC name is 13-chloro-4,4,8-trimethyl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12(17),13,15-hexaene.
| Compound Name | 13-chloro-4,4,8-trimethyl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12(17),13,15-hexaene |
|---|---|
| PubChem CID | 919208 |
| Molecular Formula | C15H14ClN3OS |
| Molecular Weight | 319.82 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 13-chloro-4,4,8-trimethyl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12(17),13,15-hexaene |
| SMILES | Cc1nc2sc3c(Cl)ncnc3c2c2c1COC(C)(C)C2 |
| InChI | InChI=1S/C15H14ClN3OS/c1-7-9-5-20-15(2,3)4-8(9)10-11-12(21-14(10)19-7)13(16)18-6-17-11/h6H,4-5H2,1-3H3 |
| InChIKey | JRSOUGYCIATRRD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |