About N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide
N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide (PubChem CID 91920923) has the molecular formula C17H24N4O3S
and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide |
| PubChem CID | 91920923 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CCN(S(=O)(=O)c2ccc(C#N)cc2)C[C@H]1N(C)C |
| InChI | InChI=1S/C17H24N4O3S/c1-13(22)19-11-15-8-9-21(12-17(15)20(2)3)25(23,24)16-6-4-14(10-18)5-7-16/h4-7,15,17H,8-9,11-12H2,1-3H3,(H,19,22)/t15-,17-/m1/s1 |
| InChIKey | CKRYWBWEEIXXQM-NVXWUHKLSA-N |
| XLogP | 0.64 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide?
The IUPAC name of N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide (CID 91920923) is N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide.
What is the SMILES notation for N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide?
The canonical SMILES for N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide is CC(=O)NC[C@H]1CCN(S(=O)(=O)c2ccc(C#N)cc2)C[C@H]1N(C)C.
What is the InChIKey of N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide?
The InChIKey is CKRYWBWEEIXXQM-NVXWUHKLSA-N. The full InChI is InChI=1S/C17H24N4O3S/c1-13(22)19-11-15-8-9-21(12-17(15)20(2)3)25(23,24)16-6-4-14(10-18)5-7-16/h4-7,15,17H,8-9,11-12H2,1-3H3,(H,19,22)/t15-,17-/m1/s1.
What are the key properties of N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide?
N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide has a molecular weight of 364.47 g/mol, XLogP of 0.64, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3S,4R)-1-(4-cyanophenyl)sulfonyl-3-(dimethylamino)piperidin-4-yl]methyl]acetamide is sourced from PubChem (CID 91920923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).