About 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane
2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane (PubChem CID 91922303) has the molecular formula C16H28N4O
and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane |
| PubChem CID | 91922303 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane |
| SMILES | COCC1CN(Cc2c(C)n[nH]c2C)CC12CCNCC2 |
| InChI | InChI=1S/C16H28N4O/c1-12-15(13(2)19-18-12)9-20-8-14(10-21-3)16(11-20)4-6-17-7-5-16/h14,17H,4-11H2,1-3H3,(H,18,19) |
| InChIKey | ZOZJRSPBSCMKTP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane?
The IUPAC name of 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane (CID 91922303) is 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane.
What is the SMILES notation for 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane?
The canonical SMILES for 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane is COCC1CN(Cc2c(C)n[nH]c2C)CC12CCNCC2.
What is the InChIKey of 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane?
The InChIKey is ZOZJRSPBSCMKTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N4O/c1-12-15(13(2)19-18-12)9-20-8-14(10-21-3)16(11-20)4-6-17-7-5-16/h14,17H,4-11H2,1-3H3,(H,18,19).
What are the key properties of 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane?
2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane has a molecular weight of 292.43 g/mol, XLogP of 1.47, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(methoxymethyl)-2,8-diazaspiro[4.5]decane is sourced from PubChem (CID 91922303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).