C12H16N4OS — CID 91922372
7-[(3-methylthiophen-2-yl)methyl]-5,6,8,9-tetrahydro-2H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-one (PubChem CID 91922372) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 7-[(3-methylthiophen-2-yl)methyl]-5,6,8,9-tetrahydro-2H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-one.
| Compound Name | 7-[(3-methylthiophen-2-yl)methyl]-5,6,8,9-tetrahydro-2H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-one |
|---|---|
| PubChem CID | 91922372 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 7-[(3-methylthiophen-2-yl)methyl]-5,6,8,9-tetrahydro-2H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-one |
| SMILES | Cc1ccsc1CN1CCc2n[nH]c(=O)n2CC1 |
| InChI | InChI=1S/C12H16N4OS/c1-9-3-7-18-10(9)8-15-4-2-11-13-14-12(17)16(11)6-5-15/h3,7H,2,4-6,8H2,1H3,(H,14,17) |
| InChIKey | JVTAFVHKSFHSNK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |