C18H25N5O2 — CID 91922607
1-[3-(methoxymethyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]-3-(2-phenylethyl)urea (PubChem CID 91922607) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-[3-(methoxymethyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]-3-(2-phenylethyl)urea.
| Compound Name | 1-[3-(methoxymethyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 91922607 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 1-[3-(methoxymethyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]-3-(2-phenylethyl)urea |
| SMILES | COCc1nnc2n1CCC(NC(=O)NCCc1ccccc1)CC2 |
| InChI | InChI=1S/C18H25N5O2/c1-25-13-17-22-21-16-8-7-15(10-12-23(16)17)20-18(24)19-11-9-14-5-3-2-4-6-14/h2-6,15H,7-13H2,1H3,(H2,19,20,24) |
| InChIKey | NXZROOZKZMLKOY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |