C17H26N4O — CID 91922642
2-(cyclohexen-1-yl)-N-methyl-N-(3-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)acetamide (PubChem CID 91922642) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-methyl-N-(3-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)acetamide.
| Compound Name | 2-(cyclohexen-1-yl)-N-methyl-N-(3-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)acetamide |
|---|---|
| PubChem CID | 91922642 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-methyl-N-(3-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl)acetamide |
| SMILES | Cc1nnc2n1CCC(N(C)C(=O)CC1=CCCCC1)CC2 |
| InChI | InChI=1S/C17H26N4O/c1-13-18-19-16-9-8-15(10-11-21(13)16)20(2)17(22)12-14-6-4-3-5-7-14/h6,15H,3-5,7-12H2,1-2H3 |
| InChIKey | UYRVOAWIDKBFPA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|