C21H28N4O3 — CID 91922654
1-(4-methoxyphenyl)-N-(3-oxo-2,5,6,7,8,9-hexahydro-[1,2,4]triazolo[4,3-a]azepin-7-yl)cyclohexane-1-carboxamide (PubChem CID 91922654) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-(3-oxo-2,5,6,7,8,9-hexahydro-[1,2,4]triazolo[4,3-a]azepin-7-yl)cyclohexane-1-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-N-(3-oxo-2,5,6,7,8,9-hexahydro-[1,2,4]triazolo[4,3-a]azepin-7-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91922654 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-(3-oxo-2,5,6,7,8,9-hexahydro-[1,2,4]triazolo[4,3-a]azepin-7-yl)cyclohexane-1-carboxamide |
| SMILES | COc1ccc(C2(C(=O)NC3CCc4n[nH]c(=O)n4CC3)CCCCC2)cc1 |
| InChI | InChI=1S/C21H28N4O3/c1-28-17-8-5-15(6-9-17)21(12-3-2-4-13-21)19(26)22-16-7-10-18-23-24-20(27)25(18)14-11-16/h5-6,8-9,16H,2-4,7,10-14H2,1H3,(H,22,26)(H,24,27) |
| InChIKey | ZRMDVSDIVXOYBG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |