C19H27N5O2S — CID 91922750
2-(7-amino-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)-N-cyclopentyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 91922750) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is 2-(7-amino-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)-N-cyclopentyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(7-amino-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)-N-cyclopentyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 91922750 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-(7-amino-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)-N-cyclopentyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | NC1CCc2nn(CC(=O)N(Cc3cccs3)C3CCCC3)c(=O)n2CC1 |
| InChI | InChI=1S/C19H27N5O2S/c20-14-7-8-17-21-24(19(26)22(17)10-9-14)13-18(25)23(15-4-1-2-5-15)12-16-6-3-11-27-16/h3,6,11,14-15H,1-2,4-5,7-10,12-13,20H2 |
| InChIKey | HDMNXHMDTQXFSC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |