About N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide
N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide (PubChem CID 91923208) has the molecular formula C17H29N3O2
and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide |
| PubChem CID | 91923208 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide |
| SMILES | CC(=O)N1C[C@@H](CN(C)C)[C@H](NC(=O)CC2=CCCCC2)C1 |
| InChI | InChI=1S/C17H29N3O2/c1-13(21)20-11-15(10-19(2)3)16(12-20)18-17(22)9-14-7-5-4-6-8-14/h7,15-16H,4-6,8-12H2,1-3H3,(H,18,22)/t15-,16-/m1/s1 |
| InChIKey | FKDILNTUPZCFDN-HZPDHXFCSA-N |
| XLogP | 1.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide?
The IUPAC name of N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide (CID 91923208) is N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide.
What is the SMILES notation for N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide?
The canonical SMILES for N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide is CC(=O)N1C[C@@H](CN(C)C)[C@H](NC(=O)CC2=CCCCC2)C1.
What is the InChIKey of N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide?
The InChIKey is FKDILNTUPZCFDN-HZPDHXFCSA-N. The full InChI is InChI=1S/C17H29N3O2/c1-13(21)20-11-15(10-19(2)3)16(12-20)18-17(22)9-14-7-5-4-6-8-14/h7,15-16H,4-6,8-12H2,1-3H3,(H,18,22)/t15-,16-/m1/s1.
What are the key properties of N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide?
N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide has a molecular weight of 307.44 g/mol, XLogP of 1.40, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,4R)-1-acetyl-4-[(dimethylamino)methyl]pyrrolidin-3-yl]-2-(cyclohexen-1-yl)acetamide is sourced from PubChem (CID 91923208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).