C18H29N3O2 — CID 91923644
1'-(2-cyclopentylacetyl)spiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one (PubChem CID 91923644) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 1'-(2-cyclopentylacetyl)spiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one.
| Compound Name | 1'-(2-cyclopentylacetyl)spiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 91923644 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 1'-(2-cyclopentylacetyl)spiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one |
| SMILES | O=C1NCCN2CC3(CCN(C(=O)CC4CCCC4)CC3)CC12 |
| InChI | InChI=1S/C18H29N3O2/c22-16(11-14-3-1-2-4-14)20-8-5-18(6-9-20)12-15-17(23)19-7-10-21(15)13-18/h14-15H,1-13H2,(H,19,23) |
| InChIKey | CODBOJZBIXNKDO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |