C17H23N3O3S — CID 91923652
1'-(benzenesulfonyl)spiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one (PubChem CID 91923652) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 1'-(benzenesulfonyl)spiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one.
| Compound Name | 1'-(benzenesulfonyl)spiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 91923652 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 1'-(benzenesulfonyl)spiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one |
| SMILES | O=C1NCCN2CC3(CCN(S(=O)(=O)c4ccccc4)CC3)CC12 |
| InChI | InChI=1S/C17H23N3O3S/c21-16-15-12-17(13-19(15)11-8-18-16)6-9-20(10-7-17)24(22,23)14-4-2-1-3-5-14/h1-5,15H,6-13H2,(H,18,21) |
| InChIKey | JHOXDDXWMIHKMH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |