C17H22FN3O3S — CID 91923655
1'-(3-fluorophenyl)sulfonylspiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one (PubChem CID 91923655) has the molecular formula C17H22FN3O3S and a molecular weight of 367.45 g/mol. Its IUPAC name is 1'-(3-fluorophenyl)sulfonylspiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one.
| Compound Name | 1'-(3-fluorophenyl)sulfonylspiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 91923655 |
| Molecular Formula | C17H22FN3O3S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1'-(3-fluorophenyl)sulfonylspiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one |
| SMILES | O=C1NCCN2CC3(CCN(S(=O)(=O)c4cccc(F)c4)CC3)CC12 |
| InChI | InChI=1S/C17H22FN3O3S/c18-13-2-1-3-14(10-13)25(23,24)21-7-4-17(5-8-21)11-15-16(22)19-6-9-20(15)12-17/h1-3,10,15H,4-9,11-12H2,(H,19,22) |
| InChIKey | VKMGNXBVMSCJDC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |