About 4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one
4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 91923779) has the molecular formula C14H17N3O4S
and a molecular weight of 323.37 g/mol. Its IUPAC name is 4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one.
Molecular Properties
| Compound Name | 4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one |
| PubChem CID | 91923779 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | CN1C(=O)CS(=O)(=O)C12CCN(C(=O)c1ccncc1)CC2 |
| InChI | InChI=1S/C14H17N3O4S/c1-16-12(18)10-22(20,21)14(16)4-8-17(9-5-14)13(19)11-2-6-15-7-3-11/h2-3,6-7H,4-5,8-10H2,1H3 |
| InChIKey | KOYJRHSXJZIGGS-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one?
The IUPAC name of 4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one (CID 91923779) is 4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one.
What is the SMILES notation for 4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one?
The canonical SMILES for 4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one is CN1C(=O)CS(=O)(=O)C12CCN(C(=O)c1ccncc1)CC2.
What is the InChIKey of 4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one?
The InChIKey is KOYJRHSXJZIGGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O4S/c1-16-12(18)10-22(20,21)14(16)4-8-17(9-5-14)13(19)11-2-6-15-7-3-11/h2-3,6-7H,4-5,8-10H2,1H3.
What are the key properties of 4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one?
4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one has a molecular weight of 323.37 g/mol, XLogP of -0.10, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,1-dioxo-8-(pyridine-4-carbonyl)-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one is sourced from PubChem (CID 91923779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).