C14H21N5O2S — CID 91923965
N-[2-[1-(cyclopropylmethyl)-5-methylimidazol-2-yl]ethyl]-1-methylimidazole-4-sulfonamide (PubChem CID 91923965) has the molecular formula C14H21N5O2S and a molecular weight of 323.42 g/mol. Its IUPAC name is N-[2-[1-(cyclopropylmethyl)-5-methylimidazol-2-yl]ethyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[2-[1-(cyclopropylmethyl)-5-methylimidazol-2-yl]ethyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 91923965 |
| Molecular Formula | C14H21N5O2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[2-[1-(cyclopropylmethyl)-5-methylimidazol-2-yl]ethyl]-1-methylimidazole-4-sulfonamide |
| SMILES | Cc1cnc(CCNS(=O)(=O)c2cn(C)cn2)n1CC1CC1 |
| InChI | InChI=1S/C14H21N5O2S/c1-11-7-15-13(19(11)8-12-3-4-12)5-6-17-22(20,21)14-9-18(2)10-16-14/h7,9-10,12,17H,3-6,8H2,1-2H3 |
| InChIKey | DZJJFYGOXSZMNH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |