C17H23N3O2S — CID 91924450
N-(3-ethoxypropyl)-3-thiophen-3-yl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 91924450) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-3-thiophen-3-yl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-3-thiophen-3-yl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 91924450 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-(3-ethoxypropyl)-3-thiophen-3-yl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCc2ncc(-c3ccsc3)n2C1 |
| InChI | InChI=1S/C17H23N3O2S/c1-2-22-8-3-7-18-17(21)13-4-5-16-19-10-15(20(16)11-13)14-6-9-23-12-14/h6,9-10,12-13H,2-5,7-8,11H2,1H3,(H,18,21) |
| InChIKey | TWJWUVJQMRZAQK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|