C23H38N4O2 — CID 91925194
1-cyclopentyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxamide (PubChem CID 91925194) has the molecular formula C23H38N4O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is 1-cyclopentyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxamide.
| Compound Name | 1-cyclopentyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxamide |
|---|---|
| PubChem CID | 91925194 |
| Molecular Formula | C23H38N4O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 1-cyclopentyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)C23CCCC=C2N(C2CCCC2)C(=O)CC3)CC1 |
| InChI | InChI=1S/C23H38N4O2/c1-25-15-17-26(18-16-25)14-6-13-24-22(29)23-11-5-4-9-20(23)27(21(28)10-12-23)19-7-2-3-8-19/h9,19H,2-8,10-18H2,1H3,(H,24,29) |
| InChIKey | DYATZUFDVAKOGO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|