C17H23N3O2 — CID 91925274
(4aR,8aR)-1-methyl-2-oxo-N-(pyridin-2-ylmethyl)-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide (PubChem CID 91925274) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (4aR,8aR)-1-methyl-2-oxo-N-(pyridin-2-ylmethyl)-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide.
| Compound Name | (4aR,8aR)-1-methyl-2-oxo-N-(pyridin-2-ylmethyl)-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide |
|---|---|
| PubChem CID | 91925274 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (4aR,8aR)-1-methyl-2-oxo-N-(pyridin-2-ylmethyl)-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide |
| SMILES | CN1C(=O)CC[C@]2(C(=O)NCc3ccccn3)CCCC[C@@H]12 |
| InChI | InChI=1S/C17H23N3O2/c1-20-14-7-2-4-9-17(14,10-8-15(20)21)16(22)19-12-13-6-3-5-11-18-13/h3,5-6,11,14H,2,4,7-10,12H2,1H3,(H,19,22)/t14-,17-/m1/s1 |
| InChIKey | MBVPTOHMSIDJEP-RHSMWYFYSA-N |
| XLogP | 1.88 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |