C23H34N2O3 — CID 91925347
(4aR,8aR)-N-[(4-methoxyphenyl)methyl]-1-(3-methylbutyl)-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide (PubChem CID 91925347) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is (4aR,8aR)-N-[(4-methoxyphenyl)methyl]-1-(3-methylbutyl)-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide.
| Compound Name | (4aR,8aR)-N-[(4-methoxyphenyl)methyl]-1-(3-methylbutyl)-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide |
|---|---|
| PubChem CID | 91925347 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | (4aR,8aR)-N-[(4-methoxyphenyl)methyl]-1-(3-methylbutyl)-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide |
| SMILES | COc1ccc(CNC(=O)[C@@]23CCCC[C@H]2N(CCC(C)C)C(=O)CC3)cc1 |
| InChI | InChI=1S/C23H34N2O3/c1-17(2)12-15-25-20-6-4-5-13-23(20,14-11-21(25)26)22(27)24-16-18-7-9-19(28-3)10-8-18/h7-10,17,20H,4-6,11-16H2,1-3H3,(H,24,27)/t20-,23-/m1/s1 |
| InChIKey | TTXMSHIBLAZMDG-NFBKMPQASA-N |
| XLogP | 3.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |