C18H30N2O2 — CID 91925352
(4aR,8aR)-N-cyclopropyl-1-(3-methylbutyl)-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide (PubChem CID 91925352) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is (4aR,8aR)-N-cyclopropyl-1-(3-methylbutyl)-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide.
| Compound Name | (4aR,8aR)-N-cyclopropyl-1-(3-methylbutyl)-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide |
|---|---|
| PubChem CID | 91925352 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | (4aR,8aR)-N-cyclopropyl-1-(3-methylbutyl)-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxamide |
| SMILES | CC(C)CCN1C(=O)CC[C@]2(C(=O)NC3CC3)CCCC[C@@H]12 |
| InChI | InChI=1S/C18H30N2O2/c1-13(2)9-12-20-15-5-3-4-10-18(15,11-8-16(20)21)17(22)19-14-6-7-14/h13-15H,3-12H2,1-2H3,(H,19,22)/t15-,18-/m1/s1 |
| InChIKey | IQRIDZBRTVTOKE-CRAIPNDOSA-N |
| XLogP | 2.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |