C19H25N3O4 — CID 91925525
3-methoxy-1-[1-(pyridine-3-carbonyl)piperidin-4-yl]-7-oxa-1-azaspiro[3.5]nonan-2-one (PubChem CID 91925525) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-methoxy-1-[1-(pyridine-3-carbonyl)piperidin-4-yl]-7-oxa-1-azaspiro[3.5]nonan-2-one.
| Compound Name | 3-methoxy-1-[1-(pyridine-3-carbonyl)piperidin-4-yl]-7-oxa-1-azaspiro[3.5]nonan-2-one |
|---|---|
| PubChem CID | 91925525 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 3-methoxy-1-[1-(pyridine-3-carbonyl)piperidin-4-yl]-7-oxa-1-azaspiro[3.5]nonan-2-one |
| SMILES | COC1C(=O)N(C2CCN(C(=O)c3cccnc3)CC2)C12CCOCC2 |
| InChI | InChI=1S/C19H25N3O4/c1-25-16-18(24)22(19(16)6-11-26-12-7-19)15-4-9-21(10-5-15)17(23)14-3-2-8-20-13-14/h2-3,8,13,15-16H,4-7,9-12H2,1H3 |
| InChIKey | GSQBBOINUFDMPM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |