C16H22ClN3O3S — CID 91925728
3-[4-(5-chlorothiophene-2-carbonyl)piperazin-1-yl]-1-(2-methoxyethyl)pyrrolidin-2-one (PubChem CID 91925728) has the molecular formula C16H22ClN3O3S and a molecular weight of 371.89 g/mol. Its IUPAC name is 3-[4-(5-chlorothiophene-2-carbonyl)piperazin-1-yl]-1-(2-methoxyethyl)pyrrolidin-2-one.
| Compound Name | 3-[4-(5-chlorothiophene-2-carbonyl)piperazin-1-yl]-1-(2-methoxyethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 91925728 |
| Molecular Formula | C16H22ClN3O3S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 3-[4-(5-chlorothiophene-2-carbonyl)piperazin-1-yl]-1-(2-methoxyethyl)pyrrolidin-2-one |
| SMILES | COCCN1CCC(N2CCN(C(=O)c3ccc(Cl)s3)CC2)C1=O |
| InChI | InChI=1S/C16H22ClN3O3S/c1-23-11-10-19-5-4-12(15(19)21)18-6-8-20(9-7-18)16(22)13-2-3-14(17)24-13/h2-3,12H,4-11H2,1H3 |
| InChIKey | JMDWOKPFHBFGDA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |