C18H26ClN3O2S — CID 91925899
3-[4-(5-chlorothiophene-2-carbonyl)piperazin-1-yl]-1-(3-methylbutyl)pyrrolidin-2-one (PubChem CID 91925899) has the molecular formula C18H26ClN3O2S and a molecular weight of 383.95 g/mol. Its IUPAC name is 3-[4-(5-chlorothiophene-2-carbonyl)piperazin-1-yl]-1-(3-methylbutyl)pyrrolidin-2-one.
| Compound Name | 3-[4-(5-chlorothiophene-2-carbonyl)piperazin-1-yl]-1-(3-methylbutyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 91925899 |
| Molecular Formula | C18H26ClN3O2S |
| Molecular Weight | 383.95 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-[4-(5-chlorothiophene-2-carbonyl)piperazin-1-yl]-1-(3-methylbutyl)pyrrolidin-2-one |
| SMILES | CC(C)CCN1CCC(N2CCN(C(=O)c3ccc(Cl)s3)CC2)C1=O |
| InChI | InChI=1S/C18H26ClN3O2S/c1-13(2)5-7-21-8-6-14(17(21)23)20-9-11-22(12-10-20)18(24)15-3-4-16(19)25-15/h3-4,13-14H,5-12H2,1-2H3 |
| InChIKey | QFRUXPJVFGJJSB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.95 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |